C22H40O12 — CID 90907476
2,2-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]decanoic acid (PubChem CID 90907476) has the molecular formula C22H40O12 and a molecular weight of 496.55 g/mol. Its IUPAC name is 2,2-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]decanoic acid.
| Compound Name | 2,2-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]decanoic acid |
|---|---|
| PubChem CID | 90907476 |
| Molecular Formula | C22H40O12 |
| Molecular Weight | 496.55 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2,2-bis[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]decanoic acid |
| SMILES | CCCCCCCCC(C(=O)O)(C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H40O12/c1-2-3-4-5-6-7-8-22(21(31)32,19-17(29)15(27)13(25)11(9-23)33-19)20-18(30)16(28)14(26)12(10-24)34-20/h11-20,23-30H,2-10H2,1H3,(H,31,32)/t11-,12-,13-,14-,15+,16+,17-,18-,19?,20?,22?/m1/s1 |
| InChIKey | QMUPSPWZVWJZIQ-AJKUPXSPSA-N |
| XLogP | -2.51 |
| TPSA | 217.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.55 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|