About 7-methyl-3,4-dihydro-2H-oxepin-5-imine
7-methyl-3,4-dihydro-2H-oxepin-5-imine (PubChem CID 90907504) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is 7-methyl-3,4-dihydro-2H-oxepin-5-imine.
Molecular Properties
| Compound Name | 7-methyl-3,4-dihydro-2H-oxepin-5-imine |
| PubChem CID | 90907504 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 7-methyl-3,4-dihydro-2H-oxepin-5-imine |
| SMILES | [H]/N=C1/C=C(C)OCCC1 |
| InChI | InChI=1S/C7H11NO/c1-6-5-7(8)3-2-4-9-6/h5,8H,2-4H2,1H3/b8-7+ |
| InChIKey | FPHCPLSFSWOSRZ-BQYQJAHWSA-N |
| XLogP | 1.72 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-3,4-dihydro-2H-oxepin-5-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,4-dihydro-2H-oxepin-5-imine?
The IUPAC name of 7-methyl-3,4-dihydro-2H-oxepin-5-imine (CID 90907504) is 7-methyl-3,4-dihydro-2H-oxepin-5-imine.
What is the SMILES notation for 7-methyl-3,4-dihydro-2H-oxepin-5-imine?
The canonical SMILES for 7-methyl-3,4-dihydro-2H-oxepin-5-imine is [H]/N=C1/C=C(C)OCCC1.
What is the InChIKey of 7-methyl-3,4-dihydro-2H-oxepin-5-imine?
The InChIKey is FPHCPLSFSWOSRZ-BQYQJAHWSA-N. The full InChI is InChI=1S/C7H11NO/c1-6-5-7(8)3-2-4-9-6/h5,8H,2-4H2,1H3/b8-7+.
What are the key properties of 7-methyl-3,4-dihydro-2H-oxepin-5-imine?
7-methyl-3,4-dihydro-2H-oxepin-5-imine has a molecular weight of 125.17 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,4-dihydro-2H-oxepin-5-imine is sourced from PubChem (CID 90907504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).