C20H22BrNO4 — CID 9090762
4-bromo-3,5-dimethoxy-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]benzamide (PubChem CID 9090762) has the molecular formula C20H22BrNO4 and a molecular weight of 420.30 g/mol. Its IUPAC name is 4-bromo-3,5-dimethoxy-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]benzamide.
| Compound Name | 4-bromo-3,5-dimethoxy-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 9090762 |
| Molecular Formula | C20H22BrNO4 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | 4-bromo-3,5-dimethoxy-N-methyl-N-[(4-prop-2-enoxyphenyl)methyl]benzamide |
| SMILES | C=CCOc1ccc(CN(C)C(=O)c2cc(OC)c(Br)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22BrNO4/c1-5-10-26-16-8-6-14(7-9-16)13-22(2)20(23)15-11-17(24-3)19(21)18(12-15)25-4/h5-9,11-12H,1,10,13H2,2-4H3 |
| InChIKey | JKYJVCHKKBYXCQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|