About 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane
5-isocyano-1,3-dimethyl-2-methylidenecyclohexane (PubChem CID 90907652) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane.
Molecular Properties
| Compound Name | 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane |
| PubChem CID | 90907652 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane |
| SMILES | [C-]#[N+]C1CC(C)C(=C)C(C)C1 |
| InChI | InChI=1S/C10H15N/c1-7-5-10(11-4)6-8(2)9(7)3/h7-8,10H,3,5-6H2,1-2H3 |
| InChIKey | FVGMCXKJDCZFPZ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane?
The IUPAC name of 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane (CID 90907652) is 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane.
What is the SMILES notation for 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane?
The canonical SMILES for 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane is [C-]#[N+]C1CC(C)C(=C)C(C)C1.
What is the InChIKey of 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane?
The InChIKey is FVGMCXKJDCZFPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N/c1-7-5-10(11-4)6-8(2)9(7)3/h7-8,10H,3,5-6H2,1-2H3.
What are the key properties of 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane?
5-isocyano-1,3-dimethyl-2-methylidenecyclohexane has a molecular weight of 149.24 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-isocyano-1,3-dimethyl-2-methylidenecyclohexane is sourced from PubChem (CID 90907652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).