C14H12F16O8 — CID 90907812
(3R,4R,5S)-3,4,5,6-tetrahydroxy-1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexan-2-one (PubChem CID 90907812) has the molecular formula C14H12F16O8 and a molecular weight of 612.21 g/mol. Its IUPAC name is (3R,4R,5S)-3,4,5,6-tetrahydroxy-1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexan-2-one.
| Compound Name | (3R,4R,5S)-3,4,5,6-tetrahydroxy-1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexan-2-one |
|---|---|
| PubChem CID | 90907812 |
| Molecular Formula | C14H12F16O8 |
| Molecular Weight | 612.21 g/mol |
| Exact Mass | 612.03 |
| IUPAC Name | (3R,4R,5S)-3,4,5,6-tetrahydroxy-1-[1,1,2-trifluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethoxy]hexan-2-one |
| SMILES | O=C(COC(F)(F)C(F)OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C14H12F16O8/c15-7(8(16,17)36-2-4(33)6(35)5(34)3(32)1-31)37-14(29,30)10(20,12(24,25)26)38-13(27,28)9(18,19)11(21,22)23/h3,5-7,31-32,34-35H,1-2H2/t3-,5+,6-,7?,10?/m0/s1 |
| InChIKey | ISIDUNHHDGBGPD-OQNGSMNPSA-N |
| XLogP | 2.18 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|