About 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid
3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid (PubChem CID 90908084) has the molecular formula C21H10ClF6N3O2
and a molecular weight of 485.77 g/mol. Its IUPAC name is 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid |
| PubChem CID | 90908084 |
| Molecular Formula | C21H10ClF6N3O2 |
| Molecular Weight | 485.77 g/mol |
| Exact Mass | 485.04 |
| IUPAC Name | 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid |
| SMILES | N#CC(=Cc1cn(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1-c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C21H10ClF6N3O2/c22-16-3-1-2-11(5-16)18-13(4-12(9-29)19(32)33)10-31(30-18)17-7-14(20(23,24)25)6-15(8-17)21(26,27)28/h1-8,10H,(H,32,33) |
| InChIKey | MPXKSVFSILZVLC-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.77 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid?
The IUPAC name of 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid (CID 90908084) is 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid.
What is the SMILES notation for 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid?
The canonical SMILES for 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid is N#CC(=Cc1cn(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1-c1cccc(Cl)c1)C(=O)O.
What is the InChIKey of 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid?
The InChIKey is MPXKSVFSILZVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H10ClF6N3O2/c22-16-3-1-2-11(5-16)18-13(4-12(9-29)19(32)33)10-31(30-18)17-7-14(20(23,24)25)6-15(8-17)21(26,27)28/h1-8,10H,(H,32,33).
What are the key properties of 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid?
3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid has a molecular weight of 485.77 g/mol, XLogP of 6.22, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[3,5-bis(trifluoromethyl)phenyl]-3-(3-chlorophenyl)pyrazol-4-yl]-2-cyanoprop-2-enoic acid is sourced from PubChem (CID 90908084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).