C22H18F4N4O — CID 90908386
[(4,6-dimethyl-2-pyridinyl)amino]-[2-[4-fluoro-2-(trifluoromethyl)phenyl]-1H-benzimidazol-4-yl]methanol (PubChem CID 90908386) has the molecular formula C22H18F4N4O and a molecular weight of 430.41 g/mol. Its IUPAC name is [(4,6-dimethyl-2-pyridinyl)amino]-[2-[4-fluoro-2-(trifluoromethyl)phenyl]-1H-benzimidazol-4-yl]methanol.
| Compound Name | [(4,6-dimethyl-2-pyridinyl)amino]-[2-[4-fluoro-2-(trifluoromethyl)phenyl]-1H-benzimidazol-4-yl]methanol |
|---|---|
| PubChem CID | 90908386 |
| Molecular Formula | C22H18F4N4O |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(4,6-dimethyl-2-pyridinyl)amino]-[2-[4-fluoro-2-(trifluoromethyl)phenyl]-1H-benzimidazol-4-yl]methanol |
| SMILES | Cc1cc(C)nc(NC(O)c2cccc3[nH]c(-c4ccc(F)cc4C(F)(F)F)nc23)c1 |
| InChI | InChI=1S/C22H18F4N4O/c1-11-8-12(2)27-18(9-11)29-21(31)15-4-3-5-17-19(15)30-20(28-17)14-7-6-13(23)10-16(14)22(24,25)26/h3-10,21,31H,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | XRTFXSCSLZCACW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|