C16H13BrN2O4S — CID 9090843
N'-(5-bromothiophene-2-carbonyl)-5-methoxy-3-methyl-1-benzofuran-2-carbohydrazide (PubChem CID 9090843) has the molecular formula C16H13BrN2O4S and a molecular weight of 409.26 g/mol. Its IUPAC name is N'-(5-bromothiophene-2-carbonyl)-5-methoxy-3-methyl-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-(5-bromothiophene-2-carbonyl)-5-methoxy-3-methyl-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 9090843 |
| Molecular Formula | C16H13BrN2O4S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | N'-(5-bromothiophene-2-carbonyl)-5-methoxy-3-methyl-1-benzofuran-2-carbohydrazide |
| SMILES | COc1ccc2oc(C(=O)NNC(=O)c3ccc(Br)s3)c(C)c2c1 |
| InChI | InChI=1S/C16H13BrN2O4S/c1-8-10-7-9(22-2)3-4-11(10)23-14(8)16(21)19-18-15(20)12-5-6-13(17)24-12/h3-7H,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | ZXJGXLXWOQJGHZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|