C18H25N — CID 90908627
N-(3,6,7-trimethylundeca-1,3,5,7,9-pentaen-2-yl)but-3-en-2-imine (PubChem CID 90908627) has the molecular formula C18H25N and a molecular weight of 255.40 g/mol. Its IUPAC name is N-(3,6,7-trimethylundeca-1,3,5,7,9-pentaen-2-yl)but-3-en-2-imine.
| Compound Name | N-(3,6,7-trimethylundeca-1,3,5,7,9-pentaen-2-yl)but-3-en-2-imine |
|---|---|
| PubChem CID | 90908627 |
| Molecular Formula | C18H25N |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.20 |
| IUPAC Name | N-(3,6,7-trimethylundeca-1,3,5,7,9-pentaen-2-yl)but-3-en-2-imine |
| SMILES | C=C/C(C)=N/C(=C)C(C)=CC=C(C)C(C)=CC=CC |
| InChI | InChI=1S/C18H25N/c1-8-10-11-14(3)15(4)12-13-16(5)18(7)19-17(6)9-2/h8-13H,2,7H2,1,3-6H3/b10-8?,14-11?,15-12?,16-13?,19-17+ |
| InChIKey | VWUTZMXGMRXCLF-SXCBFWCLSA-N |
| XLogP | 5.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|