C31H39F3N2O3 — CID 90908665
[(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] 2-[(dimethylamino)methyl]piperidine-1-carboxylate (PubChem CID 90908665) has the molecular formula C31H39F3N2O3 and a molecular weight of 544.66 g/mol. Its IUPAC name is [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] 2-[(dimethylamino)methyl]piperidine-1-carboxylate.
| Compound Name | [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] 2-[(dimethylamino)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90908665 |
| Molecular Formula | C31H39F3N2O3 |
| Molecular Weight | 544.66 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | [(4bS,7R,8aR)-4b-benzyl-7-hydroxy-7-(trifluoromethyl)-5,6,8,8a,9,10-hexahydrophenanthren-2-yl] 2-[(dimethylamino)methyl]piperidine-1-carboxylate |
| SMILES | CN(C)CC1CCCCN1C(=O)Oc1ccc2c(c1)CC[C@@H]1C[C@@](O)(C(F)(F)F)CC[C@@]21Cc1ccccc1 |
| InChI | InChI=1S/C31H39F3N2O3/c1-35(2)21-25-10-6-7-17-36(25)28(37)39-26-13-14-27-23(18-26)11-12-24-20-30(38,31(32,33)34)16-15-29(24,27)19-22-8-4-3-5-9-22/h3-5,8-9,13-14,18,24-25,38H,6-7,10-12,15-17,19-21H2,1-2H3/t24-,25?,29+,30-/m1/s1 |
| InChIKey | LZPKOSKBMHJXFZ-JENASTPHSA-N |
| XLogP | 6.12 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.66 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |