C38H49F5O8 — CID 90908889
ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentanoyl)undec-9-enoate (PubChem CID 90908889) has the molecular formula C38H49F5O8 and a molecular weight of 728.79 g/mol. Its IUPAC name is ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentanoyl)undec-9-enoate.
| Compound Name | ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentanoyl)undec-9-enoate |
|---|---|
| PubChem CID | 90908889 |
| Molecular Formula | C38H49F5O8 |
| Molecular Weight | 728.79 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | ethyl 11-[7-(methoxymethoxy)-3-[4-(methoxymethoxy)phenyl]-3-methyl-2,4-dihydrochromen-4-yl]-2-(4,4,5,5,5-pentafluoropentanoyl)undec-9-enoate |
| SMILES | CCOC(=O)C(CCCCCCC=CCC1c2ccc(OCOC)cc2OCC1(C)c1ccc(OCOC)cc1)C(=O)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C38H49F5O8/c1-5-48-35(45)31(33(44)21-22-37(39,40)38(41,42)43)13-11-9-7-6-8-10-12-14-32-30-20-19-29(51-26-47-4)23-34(30)49-24-36(32,2)27-15-17-28(18-16-27)50-25-46-3/h10,12,15-20,23,31-32H,5-9,11,13-14,21-22,24-26H2,1-4H3 |
| InChIKey | CFZAGFODWWNQET-UHFFFAOYSA-N |
| XLogP | 9.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.79 |
| LogP ≤ 5 | 9.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|