C10H20N2 — CID 90908969
N'-hexa-2,4-dien-2-yl-N,N'-dimethylethane-1,2-diamine (PubChem CID 90908969) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N'-hexa-2,4-dien-2-yl-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-hexa-2,4-dien-2-yl-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 90908969 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N'-hexa-2,4-dien-2-yl-N,N'-dimethylethane-1,2-diamine |
| SMILES | CC=CC=C(C)N(C)CCNC |
| InChI | InChI=1S/C10H20N2/c1-5-6-7-10(2)12(4)9-8-11-3/h5-7,11H,8-9H2,1-4H3 |
| InChIKey | YFZOHUJFVFRUEW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|