About 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane
1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane (PubChem CID 90909412) has the molecular formula C13H22
and a molecular weight of 178.32 g/mol. Its IUPAC name is 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane.
Molecular Properties
| Compound Name | 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane |
| PubChem CID | 90909412 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane |
| SMILES | C=CCC(=CCC1CC1CC)CC |
| InChI | InChI=1S/C13H22/c1-4-7-11(5-2)8-9-13-10-12(13)6-3/h4,8,12-13H,1,5-7,9-10H2,2-3H3 |
| InChIKey | BPTVHWJAVUMOEE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane?
The IUPAC name of 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane (CID 90909412) is 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane.
What is the SMILES notation for 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane?
The canonical SMILES for 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane is C=CCC(=CCC1CC1CC)CC.
What is the InChIKey of 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane?
The InChIKey is BPTVHWJAVUMOEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22/c1-4-7-11(5-2)8-9-13-10-12(13)6-3/h4,8,12-13H,1,5-7,9-10H2,2-3H3.
What are the key properties of 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane?
1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane has a molecular weight of 178.32 g/mol, XLogP of 4.34, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-(3-ethylhexa-2,5-dienyl)cyclopropane is sourced from PubChem (CID 90909412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).