C13H2F18O2 — CID 90909570
3-fluoro-2-[2,3,3,4,5,5,6,6-octafluoro-1,7,7-tris(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid (PubChem CID 90909570) has the molecular formula C13H2F18O2 and a molecular weight of 532.12 g/mol. Its IUPAC name is 3-fluoro-2-[2,3,3,4,5,5,6,6-octafluoro-1,7,7-tris(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid.
| Compound Name | 3-fluoro-2-[2,3,3,4,5,5,6,6-octafluoro-1,7,7-tris(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 90909570 |
| Molecular Formula | C13H2F18O2 |
| Molecular Weight | 532.12 g/mol |
| Exact Mass | 531.98 |
| IUPAC Name | 3-fluoro-2-[2,3,3,4,5,5,6,6-octafluoro-1,7,7-tris(trifluoromethyl)-2-bicyclo[2.2.1]heptanyl]prop-2-enoic acid |
| SMILES | O=C(O)C(=CF)C1(F)C(F)(F)C2(F)C(F)(F)C(F)(F)C1(C(F)(F)F)C2(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H2F18O2/c14-1-2(3(32)33)4(15)5(11(23,24)25)6(12(26,27)28,13(29,30)31)7(16,8(4,17)18)10(21,22)9(5,19)20/h1H,(H,32,33) |
| InChIKey | PQVFDKNYJAWRPX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.12 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|