C26H24O2 — CID 90909795
[(1R,2R,4S)-2-methyl-2-bicyclo[2.2.1]heptanyl] 2-pyren-1-ylacetate (PubChem CID 90909795) has the molecular formula C26H24O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is [(1R,2R,4S)-2-methyl-2-bicyclo[2.2.1]heptanyl] 2-pyren-1-ylacetate.
| Compound Name | [(1R,2R,4S)-2-methyl-2-bicyclo[2.2.1]heptanyl] 2-pyren-1-ylacetate |
|---|---|
| PubChem CID | 90909795 |
| Molecular Formula | C26H24O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | [(1R,2R,4S)-2-methyl-2-bicyclo[2.2.1]heptanyl] 2-pyren-1-ylacetate |
| SMILES | C[C@@]1(OC(=O)Cc2ccc3ccc4cccc5ccc2c3c45)C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C26H24O2/c1-26(15-16-5-11-21(26)13-16)28-23(27)14-20-9-8-19-7-6-17-3-2-4-18-10-12-22(20)25(19)24(17)18/h2-4,6-10,12,16,21H,5,11,13-15H2,1H3/t16-,21+,26+/m0/s1 |
| InChIKey | BSLCUJMAVYJNQV-YGNPSHASSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|