C35H31IN4 — CID 90909906
15-(4-iodophenyl)-3,3-dimethyl-10-(4-methylphenyl)-2,4,21,24-tetrahydro-1H-porphyrin (PubChem CID 90909906) has the molecular formula C35H31IN4 and a molecular weight of 634.57 g/mol. Its IUPAC name is 15-(4-iodophenyl)-3,3-dimethyl-10-(4-methylphenyl)-2,4,21,24-tetrahydro-1H-porphyrin.
| Compound Name | 15-(4-iodophenyl)-3,3-dimethyl-10-(4-methylphenyl)-2,4,21,24-tetrahydro-1H-porphyrin |
|---|---|
| PubChem CID | 90909906 |
| Molecular Formula | C35H31IN4 |
| Molecular Weight | 634.57 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | 15-(4-iodophenyl)-3,3-dimethyl-10-(4-methylphenyl)-2,4,21,24-tetrahydro-1H-porphyrin |
| SMILES | Cc1ccc(C2=C3C=CC(=N3)C(c3ccc(I)cc3)=c3ccc([nH]3)=CC3CC(C)(C)C(C=C4C=CC2=N4)N3)cc1 |
| InChI | InChI=1S/C35H31IN4/c1-21-4-6-22(7-5-21)33-29-15-13-26(38-29)19-32-35(2,3)20-27(39-32)18-25-12-14-28(37-25)34(31-17-16-30(33)40-31)23-8-10-24(36)11-9-23/h4-19,27,32,37,39H,20H2,1-3H3 |
| InChIKey | HLVAJECFEOGPHC-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.57 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|