C26H33N3O3 — CID 90909907
7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(5-methylhex-2-enoyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide (PubChem CID 90909907) has the molecular formula C26H33N3O3 and a molecular weight of 435.57 g/mol. Its IUPAC name is 7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(5-methylhex-2-enoyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide.
| Compound Name | 7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(5-methylhex-2-enoyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 90909907 |
| Molecular Formula | C26H33N3O3 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 7-amino-N-(4-hydroxy-2,3,5-trimethylphenyl)-2-(5-methylhex-2-enoyl)-3,4-dihydro-1H-isoquinoline-1-carboxamide |
| SMILES | Cc1cc(NC(=O)C2c3cc(N)ccc3CCN2C(=O)C=CCC(C)C)c(C)c(C)c1O |
| InChI | InChI=1S/C26H33N3O3/c1-15(2)7-6-8-23(30)29-12-11-19-9-10-20(27)14-21(19)24(29)26(32)28-22-13-16(3)25(31)18(5)17(22)4/h6,8-10,13-15,24,31H,7,11-12,27H2,1-5H3,(H,28,32) |
| InChIKey | FBZLHPRLLCAJQW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|