C24H22N4O2S — CID 90909974
tert-butyl 3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]prop-2-enoate (PubChem CID 90909974) has the molecular formula C24H22N4O2S and a molecular weight of 430.53 g/mol. Its IUPAC name is tert-butyl 3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]prop-2-enoate.
| Compound Name | tert-butyl 3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 90909974 |
| Molecular Formula | C24H22N4O2S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | tert-butyl 3-[5-cyano-4-[(4-methyl-1H-indol-5-yl)amino]thieno[2,3-b]pyridin-2-yl]prop-2-enoate |
| SMILES | Cc1c(Nc2c(C#N)cnc3sc(C=CC(=O)OC(C)(C)C)cc23)ccc2[nH]ccc12 |
| InChI | InChI=1S/C24H22N4O2S/c1-14-17-9-10-26-20(17)7-6-19(14)28-22-15(12-25)13-27-23-18(22)11-16(31-23)5-8-21(29)30-24(2,3)4/h5-11,13,26H,1-4H3,(H,27,28) |
| InChIKey | IUDYTHUEVRMXFK-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 90.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|