C22H24F3NO4 — CID 90910067
3-[3-[C-methyl-N-[[3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]-2-propan-2-yloxypropanoic acid (PubChem CID 90910067) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3-[3-[C-methyl-N-[[3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]-2-propan-2-yloxypropanoic acid.
| Compound Name | 3-[3-[C-methyl-N-[[3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]-2-propan-2-yloxypropanoic acid |
|---|---|
| PubChem CID | 90910067 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-[3-[C-methyl-N-[[3-(trifluoromethyl)phenyl]methoxy]carbonimidoyl]phenyl]-2-propan-2-yloxypropanoic acid |
| SMILES | CC(=NOCc1cccc(C(F)(F)F)c1)c1cccc(CC(OC(C)C)C(=O)O)c1 |
| InChI | InChI=1S/C22H24F3NO4/c1-14(2)30-20(21(27)28)12-16-6-4-8-18(10-16)15(3)26-29-13-17-7-5-9-19(11-17)22(23,24)25/h4-11,14,20H,12-13H2,1-3H3,(H,27,28) |
| InChIKey | CKASSLSLQCSCEF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|