About 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile
4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile (PubChem CID 90910332) has the molecular formula C16H11FN4
and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile |
| PubChem CID | 90910332 |
| Molecular Formula | C16H11FN4 |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile |
| SMILES | [C-]#[N+]C1=C(C)N=C(C)C(C#N)C1c1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C16H11FN4/c1-9-13(8-19)15(16(20-3)10(2)21-9)11-4-5-14(17)12(6-11)7-18/h4-6,13,15H,1-2H3 |
| InChIKey | NEXWCKOWEUFTGT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 64.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The IUPAC name of 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile (CID 90910332) is 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile.
What is the SMILES notation for 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The canonical SMILES for 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile is [C-]#[N+]C1=C(C)N=C(C)C(C#N)C1c1ccc(F)c(C#N)c1.
What is the InChIKey of 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile?
The InChIKey is NEXWCKOWEUFTGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11FN4/c1-9-13(8-19)15(16(20-3)10(2)21-9)11-4-5-14(17)12(6-11)7-18/h4-6,13,15H,1-2H3.
What are the key properties of 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile?
4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile has a molecular weight of 278.29 g/mol, XLogP of 3.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-cyano-4-fluorophenyl)-5-isocyano-2,6-dimethyl-3,4-dihydropyridine-3-carbonitrile is sourced from PubChem (CID 90910332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).