C16H22N2O4 — CID 90910582
7,15-dihydroxy-4,12-diazapentacyclo[8.6.1.12,5.013,17.09,18]octadecane-8,16-dione (PubChem CID 90910582) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 7,15-dihydroxy-4,12-diazapentacyclo[8.6.1.12,5.013,17.09,18]octadecane-8,16-dione.
| Compound Name | 7,15-dihydroxy-4,12-diazapentacyclo[8.6.1.12,5.013,17.09,18]octadecane-8,16-dione |
|---|---|
| PubChem CID | 90910582 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 7,15-dihydroxy-4,12-diazapentacyclo[8.6.1.12,5.013,17.09,18]octadecane-8,16-dione |
| SMILES | O=C1C(O)CC2NCC3C4C(=O)C(O)CC5NCC(C1C23)C54 |
| InChI | InChI=1S/C16H22N2O4/c19-9-1-7-11-5(3-17-7)14-12-6(13(11)15(9)21)4-18-8(12)2-10(20)16(14)22/h5-14,17-20H,1-4H2 |
| InChIKey | KTMRQJKNVREIOR-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |