About [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol
[1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol (PubChem CID 90910629) has the molecular formula C17H12Cl3NO
and a molecular weight of 352.65 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol.
Molecular Properties
| Compound Name | [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol |
| PubChem CID | 90910629 |
| Molecular Formula | C17H12Cl3NO |
| Molecular Weight | 352.65 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol |
| SMILES | OCc1ccc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12Cl3NO/c18-11-1-4-13(5-2-11)21-14(10-22)6-8-17(21)15-7-3-12(19)9-16(15)20/h1-9,22H,10H2 |
| InChIKey | XOBKGHBTOFDPAH-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.65 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol?
The IUPAC name of [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol (CID 90910629) is [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol.
What is the SMILES notation for [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol?
The canonical SMILES for [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol is OCc1ccc(-c2ccc(Cl)cc2Cl)n1-c1ccc(Cl)cc1.
What is the InChIKey of [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol?
The InChIKey is XOBKGHBTOFDPAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl3NO/c18-11-1-4-13(5-2-11)21-14(10-22)6-8-17(21)15-7-3-12(19)9-16(15)20/h1-9,22H,10H2.
What are the key properties of [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol?
[1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol has a molecular weight of 352.65 g/mol, XLogP of 5.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chlorophenyl)-5-(2,4-dichlorophenyl)pyrrol-2-yl]methanol is sourced from PubChem (CID 90910629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).