About [azido(phenyl)methyl] dihydrogen phosphate
[azido(phenyl)methyl] dihydrogen phosphate (PubChem CID 90910738) has the molecular formula C7H8N3O4P
and a molecular weight of 229.13 g/mol. Its IUPAC name is [azido(phenyl)methyl] dihydrogen phosphate.
Molecular Properties
| Compound Name | [azido(phenyl)methyl] dihydrogen phosphate |
| PubChem CID | 90910738 |
| Molecular Formula | C7H8N3O4P |
| Molecular Weight | 229.13 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | [azido(phenyl)methyl] dihydrogen phosphate |
| SMILES | [N-]=[N+]=NC(OP(=O)(O)O)c1ccccc1 |
| InChI | InChI=1S/C7H8N3O4P/c8-10-9-7(14-15(11,12)13)6-4-2-1-3-5-6/h1-5,7H,(H2,11,12,13) |
| InChIKey | BXPNTDPMFSVKQQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.13 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [azido(phenyl)methyl] dihydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [azido(phenyl)methyl] dihydrogen phosphate?
The IUPAC name of [azido(phenyl)methyl] dihydrogen phosphate (CID 90910738) is [azido(phenyl)methyl] dihydrogen phosphate.
What is the SMILES notation for [azido(phenyl)methyl] dihydrogen phosphate?
The canonical SMILES for [azido(phenyl)methyl] dihydrogen phosphate is [N-]=[N+]=NC(OP(=O)(O)O)c1ccccc1.
What is the InChIKey of [azido(phenyl)methyl] dihydrogen phosphate?
The InChIKey is BXPNTDPMFSVKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N3O4P/c8-10-9-7(14-15(11,12)13)6-4-2-1-3-5-6/h1-5,7H,(H2,11,12,13).
What are the key properties of [azido(phenyl)methyl] dihydrogen phosphate?
[azido(phenyl)methyl] dihydrogen phosphate has a molecular weight of 229.13 g/mol, XLogP of 2.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [azido(phenyl)methyl] dihydrogen phosphate is sourced from PubChem (CID 90910738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).