C23H20BrCl2FN6O3 — CID 90910935
6-bromo-4-chloro-N-(2-chloro-6-methylphenyl)-2-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-hydroxybenzamide (PubChem CID 90910935) has the molecular formula C23H20BrCl2FN6O3 and a molecular weight of 598.26 g/mol. Its IUPAC name is 6-bromo-4-chloro-N-(2-chloro-6-methylphenyl)-2-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-hydroxybenzamide.
| Compound Name | 6-bromo-4-chloro-N-(2-chloro-6-methylphenyl)-2-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 90910935 |
| Molecular Formula | C23H20BrCl2FN6O3 |
| Molecular Weight | 598.26 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | 6-bromo-4-chloro-N-(2-chloro-6-methylphenyl)-2-[[(5-fluoro-4-morpholin-4-ylpyrimidin-2-yl)diazenyl]methyl]-3-hydroxybenzamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)c1c(Br)cc(Cl)c(O)c1C/N=N/c1ncc(F)c(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H20BrCl2FN6O3/c1-12-3-2-4-15(25)19(12)30-22(35)18-13(20(34)16(26)9-14(18)24)10-29-32-23-28-11-17(27)21(31-23)33-5-7-36-8-6-33/h2-4,9,11,34H,5-8,10H2,1H3,(H,30,35)/b32-29+ |
| InChIKey | AQYPOBQRCCXFDQ-UUDCSCGESA-N |
| XLogP | 6.07 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.26 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|