C23H40N2 — CID 90911155
9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3,9-diazaspiro[5.5]undecane (PubChem CID 90911155) has the molecular formula C23H40N2 and a molecular weight of 344.59 g/mol. Its IUPAC name is 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 90911155 |
| Molecular Formula | C23H40N2 |
| Molecular Weight | 344.59 g/mol |
| Exact Mass | 344.32 |
| IUPAC Name | 9-methyl-3-(2,4,5-trimethyldeca-5,7,9-trien-2-yl)-3,9-diazaspiro[5.5]undecane |
| SMILES | C=CC=CC=C(C)C(C)CC(C)(C)N1CCC2(CCN(C)CC2)CC1 |
| InChI | InChI=1S/C23H40N2/c1-7-8-9-10-20(2)21(3)19-22(4,5)25-17-13-23(14-18-25)11-15-24(6)16-12-23/h7-10,21H,1,11-19H2,2-6H3 |
| InChIKey | QNMJWMBUEBXACF-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.59 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|