About 1-phenyl-3-(2,2,2-trichloroethyl)benzene
1-phenyl-3-(2,2,2-trichloroethyl)benzene (PubChem CID 90911964) has the molecular formula C14H11Cl3
and a molecular weight of 285.60 g/mol. Its IUPAC name is 1-phenyl-3-(2,2,2-trichloroethyl)benzene.
Molecular Properties
| Compound Name | 1-phenyl-3-(2,2,2-trichloroethyl)benzene |
| PubChem CID | 90911964 |
| Molecular Formula | C14H11Cl3 |
| Molecular Weight | 285.60 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 1-phenyl-3-(2,2,2-trichloroethyl)benzene |
| SMILES | ClC(Cl)(Cl)Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C14H11Cl3/c15-14(16,17)10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10H2 |
| InChIKey | JQMNCXXDZJSNJG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-3-(2,2,2-trichloroethyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-(2,2,2-trichloroethyl)benzene?
The IUPAC name of 1-phenyl-3-(2,2,2-trichloroethyl)benzene (CID 90911964) is 1-phenyl-3-(2,2,2-trichloroethyl)benzene.
What is the SMILES notation for 1-phenyl-3-(2,2,2-trichloroethyl)benzene?
The canonical SMILES for 1-phenyl-3-(2,2,2-trichloroethyl)benzene is ClC(Cl)(Cl)Cc1cccc(-c2ccccc2)c1.
What is the InChIKey of 1-phenyl-3-(2,2,2-trichloroethyl)benzene?
The InChIKey is JQMNCXXDZJSNJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl3/c15-14(16,17)10-11-5-4-8-13(9-11)12-6-2-1-3-7-12/h1-9H,10H2.
What are the key properties of 1-phenyl-3-(2,2,2-trichloroethyl)benzene?
1-phenyl-3-(2,2,2-trichloroethyl)benzene has a molecular weight of 285.60 g/mol, XLogP of 5.27, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-(2,2,2-trichloroethyl)benzene is sourced from PubChem (CID 90911964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).