C18H16ClF2N3O2 — CID 90912270
[1-[(5-chloro-2-methoxyphenyl)methyl]pyrazol-3-yl]-(2,6-difluoroanilino)methanol (PubChem CID 90912270) has the molecular formula C18H16ClF2N3O2 and a molecular weight of 379.79 g/mol. Its IUPAC name is [1-[(5-chloro-2-methoxyphenyl)methyl]pyrazol-3-yl]-(2,6-difluoroanilino)methanol.
| Compound Name | [1-[(5-chloro-2-methoxyphenyl)methyl]pyrazol-3-yl]-(2,6-difluoroanilino)methanol |
|---|---|
| PubChem CID | 90912270 |
| Molecular Formula | C18H16ClF2N3O2 |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | [1-[(5-chloro-2-methoxyphenyl)methyl]pyrazol-3-yl]-(2,6-difluoroanilino)methanol |
| SMILES | COc1ccc(Cl)cc1Cn1ccc(C(O)Nc2c(F)cccc2F)n1 |
| InChI | InChI=1S/C18H16ClF2N3O2/c1-26-16-6-5-12(19)9-11(16)10-24-8-7-15(23-24)18(25)22-17-13(20)3-2-4-14(17)21/h2-9,18,22,25H,10H2,1H3 |
| InChIKey | CEQZHOYBZVMLJM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|