C31H54N4O15P2+2 — CID 90912418
bis([(E,2S,3R)-2-acetamido-3-acetyloxyhex-4-enoxy]-oxo-prop-2-enoxyphosphanium);1,3-bis(2-hydroxyethyl)urea (PubChem CID 90912418) has the molecular formula C31H54N4O15P2+2 and a molecular weight of 784.73 g/mol. Its IUPAC name is bis([(E,2S,3R)-2-acetamido-3-acetyloxyhex-4-enoxy]-oxo-prop-2-enoxyphosphanium);1,3-bis(2-hydroxyethyl)urea.
| Compound Name | bis([(E,2S,3R)-2-acetamido-3-acetyloxyhex-4-enoxy]-oxo-prop-2-enoxyphosphanium);1,3-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 90912418 |
| Molecular Formula | C31H54N4O15P2+2 |
| Molecular Weight | 784.73 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | bis([(E,2S,3R)-2-acetamido-3-acetyloxyhex-4-enoxy]-oxo-prop-2-enoxyphosphanium);1,3-bis(2-hydroxyethyl)urea |
| SMILES | C=CCO[P+](=O)OC[C@H](NC(C)=O)[C@@H](/C=C/C)OC(C)=O.C=CCO[P+](=O)OC[C@H](NC(C)=O)[C@@H](/C=C/C)OC(C)=O.O=C(NCCO)NCCO |
| InChI | InChI=1S/2C13H20NO6P.C5H12N2O3/c2*1-5-7-13(20-11(4)16)12(14-10(3)15)9-19-21(17)18-8-6-2;8-3-1-6-5(10)7-2-4-9/h2*5-7,12-13H,2,8-9H2,1,3-4H3;8-9H,1-4H2,(H2,6,7,10)/p+2/b2*7-5+;/t2*12-,13+;/m00./s1 |
| InChIKey | OGEXEVICYWPWQI-FAJQASMLSA-P |
| XLogP | 2.02 |
| TPSA | 263.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.73 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|