C13H10FNO6 — CID 90912887
4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylic acid (PubChem CID 90912887) has the molecular formula C13H10FNO6 and a molecular weight of 295.22 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylic acid |
|---|---|
| PubChem CID | 90912887 |
| Molecular Formula | C13H10FNO6 |
| Molecular Weight | 295.22 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 4-(4-fluorophenyl)-2,6-dioxopiperidine-3,5-dicarboxylic acid |
| SMILES | O=C(O)C1C(=O)NC(=O)C(C(=O)O)C1c1ccc(F)cc1 |
| InChI | InChI=1S/C13H10FNO6/c14-6-3-1-5(2-4-6)7-8(12(18)19)10(16)15-11(17)9(7)13(20)21/h1-4,7-9H,(H,18,19)(H,20,21)(H,15,16,17) |
| InChIKey | QYSHFWCNGLOYRF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|