C41H77N9O5S — CID 90913166
2-[[4,6-bis[bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]sulfanyl]ethanol (PubChem CID 90913166) has the molecular formula C41H77N9O5S and a molecular weight of 808.19 g/mol. Its IUPAC name is 2-[[4,6-bis[bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]sulfanyl]ethanol.
| Compound Name | 2-[[4,6-bis[bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]sulfanyl]ethanol |
|---|---|
| PubChem CID | 90913166 |
| Molecular Formula | C41H77N9O5S |
| Molecular Weight | 808.19 g/mol |
| Exact Mass | 807.58 |
| IUPAC Name | 2-[[4,6-bis[bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-1,3,5-triazin-2-yl]sulfanyl]ethanol |
| SMILES | CC1(C)CC(N(c2nc(SCCO)nc(N(C3CC(C)(C)N(O)C(C)(C)C3)C3CC(C)(C)N(O)C(C)(C)C3)n2)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C41H77N9O5S/c1-34(2)19-27(20-35(3,4)47(34)52)45(28-21-36(5,6)48(53)37(7,8)22-28)31-42-32(44-33(43-31)56-18-17-51)46(29-23-38(9,10)49(54)39(11,12)24-29)30-25-40(13,14)50(55)41(15,16)26-30/h27-30,51-55H,17-26H2,1-16H3 |
| InChIKey | IEVCBDOBOXBUBA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.19 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |