C45H32N4O — CID 90913618
4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzaldehyde (PubChem CID 90913618) has the molecular formula C45H32N4O and a molecular weight of 644.78 g/mol. Its IUPAC name is 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzaldehyde.
| Compound Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzaldehyde |
|---|---|
| PubChem CID | 90913618 |
| Molecular Formula | C45H32N4O |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 4-(10,15,20-triphenyl-21,22,23,24-tetrahydroporphyrin-5-yl)benzaldehyde |
| SMILES | O=Cc1ccc(C2=c3ccc([nH]3)=C(c3ccccc3)c3ccc([nH]3)C(c3ccccc3)=c3ccc([nH]3)=C(c3ccccc3)c3ccc2[nH]3)cc1 |
| InChI | InChI=1S/C45H32N4O/c50-28-29-16-18-33(19-17-29)45-40-26-24-38(48-40)43(31-12-6-2-7-13-31)36-22-20-34(46-36)42(30-10-4-1-5-11-30)35-21-23-37(47-35)44(32-14-8-3-9-15-32)39-25-27-41(45)49-39/h1-28,46-49H |
| InChIKey | YGPIFZNMIIVKBK-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|