C47H58Si2 — CID 90913655
tri(propan-2-yl)-[2-[15-[2-tri(propan-2-yl)silylethynyl]-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane (PubChem CID 90913655) has the molecular formula C47H58Si2 and a molecular weight of 679.15 g/mol. Its IUPAC name is tri(propan-2-yl)-[2-[15-[2-tri(propan-2-yl)silylethynyl]-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane.
| Compound Name | tri(propan-2-yl)-[2-[15-[2-tri(propan-2-yl)silylethynyl]-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane |
|---|---|
| PubChem CID | 90913655 |
| Molecular Formula | C47H58Si2 |
| Molecular Weight | 679.15 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | tri(propan-2-yl)-[2-[15-[2-tri(propan-2-yl)silylethynyl]-24-hexacyclo[11.11.1.01,10.04,9.014,19.021,25]pentacosa-2,5,7,9,11,13,15,17,19,21,23-undecaenyl]ethynyl]silane |
| SMILES | CC(C)[Si](C#CC1=CC=C2C=c3cccc(C#C[Si](C(C)C)(C(C)C)C(C)C)c3=C3C=CC4=C5C=CC=CC5C=CC14C23)(C(C)C)C(C)C |
| InChI | InChI=1S/C47H58Si2/c1-31(2)48(32(3)4,33(5)6)28-25-38-17-15-18-39-30-40-20-21-41(26-29-49(34(7)8,35(9)10)36(11)12)47-27-24-37-16-13-14-19-42(37)44(47)23-22-43(45(38)39)46(40)47/h13-24,27,30-37,46H,1-12H3 |
| InChIKey | IYCOOAGYRPBCIK-UHFFFAOYSA-N |
| XLogP | 11.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.15 |
| LogP ≤ 5 | 11.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|