C20H22N2O4S — CID 9091381
(E)-3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylphenyl)sulfanylacetyl]prop-2-enehydrazide (PubChem CID 9091381) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylphenyl)sulfanylacetyl]prop-2-enehydrazide.
| Compound Name | (E)-3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylphenyl)sulfanylacetyl]prop-2-enehydrazide |
|---|---|
| PubChem CID | 9091381 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | (E)-3-(3,5-dimethoxyphenyl)-N'-[2-(4-methylphenyl)sulfanylacetyl]prop-2-enehydrazide |
| SMILES | COc1cc(/C=C/C(=O)NNC(=O)CSc2ccc(C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-14-4-7-18(8-5-14)27-13-20(24)22-21-19(23)9-6-15-10-16(25-2)12-17(11-15)26-3/h4-12H,13H2,1-3H3,(H,21,23)(H,22,24)/b9-6+ |
| InChIKey | UUCAMBPEPOXOIA-RMKNXTFCSA-N |
| XLogP | 2.97 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|