About 4-propylcyclohexa-1,5-dien-1-ol
4-propylcyclohexa-1,5-dien-1-ol (PubChem CID 90914554) has the molecular formula C9H13O+
and a molecular weight of 137.20 g/mol. Its IUPAC name is 4-propylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | 4-propylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 90914554 |
| Molecular Formula | C9H13O+ |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 4-propylcyclohexa-1,5-dien-1-ol |
| SMILES | [CH2+]CCC1C=CC(O)=CC1 |
| InChI | InChI=1S/C9H12O/c1-2-3-8-4-6-9(10)7-5-8/h4,6-8H,1-3,5H2/p+1 |
| InChIKey | PIHFKIGFJPCOSO-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-propylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propylcyclohexa-1,5-dien-1-ol?
The IUPAC name of 4-propylcyclohexa-1,5-dien-1-ol (CID 90914554) is 4-propylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for 4-propylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for 4-propylcyclohexa-1,5-dien-1-ol is [CH2+]CCC1C=CC(O)=CC1.
What is the InChIKey of 4-propylcyclohexa-1,5-dien-1-ol?
The InChIKey is PIHFKIGFJPCOSO-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H12O/c1-2-3-8-4-6-9(10)7-5-8/h4,6-8H,1-3,5H2/p+1.
What are the key properties of 4-propylcyclohexa-1,5-dien-1-ol?
4-propylcyclohexa-1,5-dien-1-ol has a molecular weight of 137.20 g/mol, XLogP of 2.62, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 90914554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).