About 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one
2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one (PubChem CID 90914673) has the molecular formula C10H21NO2
and a molecular weight of 187.28 g/mol. Its IUPAC name is 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one |
| PubChem CID | 90914673 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)C.CC[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C5H9NO2.C5H12/c1-2-4-3-8-5(7)6-4;1-5(2,3)4/h4H,2-3H2,1H3,(H,6,7);1-4H3/t4-;/m1./s1 |
| InChIKey | KZJOQCVRCWONBS-PGMHMLKASA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one?
The IUPAC name of 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one (CID 90914673) is 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one.
What is the SMILES notation for 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one?
The canonical SMILES for 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one is CC(C)(C)C.CC[C@@H]1COC(=O)N1.
What is the InChIKey of 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one?
The InChIKey is KZJOQCVRCWONBS-PGMHMLKASA-N. The full InChI is InChI=1S/C5H9NO2.C5H12/c1-2-4-3-8-5(7)6-4;1-5(2,3)4/h4H,2-3H2,1H3,(H,6,7);1-4H3/t4-;/m1./s1.
What are the key properties of 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one?
2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one has a molecular weight of 187.28 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpropane;(4R)-4-ethyl-1,3-oxazolidin-2-one is sourced from PubChem (CID 90914673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).