C27H33N2O4+ — CID 90914790
3-[[3,4-dimethoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-5-hydroxy-1H-imidazol-3-ium-2-one (PubChem CID 90914790) has the molecular formula C27H33N2O4+ and a molecular weight of 449.57 g/mol. Its IUPAC name is 3-[[3,4-dimethoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-5-hydroxy-1H-imidazol-3-ium-2-one.
| Compound Name | 3-[[3,4-dimethoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-5-hydroxy-1H-imidazol-3-ium-2-one |
|---|---|
| PubChem CID | 90914790 |
| Molecular Formula | C27H33N2O4+ |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 3-[[3,4-dimethoxy-5-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)phenyl]methylidene]-5-hydroxy-1H-imidazol-3-ium-2-one |
| SMILES | COc1cc(C=[N+]2C=C(O)NC2=O)cc(-c2cc3c(cc2C)C(C)(C)CCC3(C)C)c1OC |
| InChI | InChI=1S/C27H32N2O4/c1-16-10-20-21(27(4,5)9-8-26(20,2)3)13-18(16)19-11-17(12-22(32-6)24(19)33-7)14-29-15-23(30)28-25(29)31/h10-15H,8-9H2,1-7H3,(H-,28,30,31)/p+1 |
| InChIKey | RJXDKNQWVNPUAU-UHFFFAOYSA-O |
| XLogP | 5.54 |
| TPSA | 70.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|