C20H17ClN4O3 — CID 9091495
1-(2-chlorophenyl)-6-methyl-N-[4-(methylcarbamoyl)phenyl]-4-oxopyridazine-3-carboxamide (PubChem CID 9091495) has the molecular formula C20H17ClN4O3 and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-6-methyl-N-[4-(methylcarbamoyl)phenyl]-4-oxopyridazine-3-carboxamide.
| Compound Name | 1-(2-chlorophenyl)-6-methyl-N-[4-(methylcarbamoyl)phenyl]-4-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 9091495 |
| Molecular Formula | C20H17ClN4O3 |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-(2-chlorophenyl)-6-methyl-N-[4-(methylcarbamoyl)phenyl]-4-oxopyridazine-3-carboxamide |
| SMILES | CNC(=O)c1ccc(NC(=O)c2nn(-c3ccccc3Cl)c(C)cc2=O)cc1 |
| InChI | InChI=1S/C20H17ClN4O3/c1-12-11-17(26)18(24-25(12)16-6-4-3-5-15(16)21)20(28)23-14-9-7-13(8-10-14)19(27)22-2/h3-11H,1-2H3,(H,22,27)(H,23,28) |
| InChIKey | ZMZZWKXZWXFICO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |