C12H16O3 — CID 90915422
3-methoxy-2-(1-methoxy-2-methylprop-2-enylidene)hexa-3,5-dienal (PubChem CID 90915422) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-methoxy-2-(1-methoxy-2-methylprop-2-enylidene)hexa-3,5-dienal.
| Compound Name | 3-methoxy-2-(1-methoxy-2-methylprop-2-enylidene)hexa-3,5-dienal |
|---|---|
| PubChem CID | 90915422 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-methoxy-2-(1-methoxy-2-methylprop-2-enylidene)hexa-3,5-dienal |
| SMILES | C=CC=C(OC)C(C=O)=C(OC)C(=C)C |
| InChI | InChI=1S/C12H16O3/c1-6-7-11(14-4)10(8-13)12(15-5)9(2)3/h6-8H,1-2H2,3-5H3 |
| InChIKey | YROJNNHRZBFYKI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|