C26H44 — CID 90915561
4-ethyl-5,11,12-trimethyl-6-(3-methylpent-3-en-1-ynyl)pentadeca-1,4-diene (PubChem CID 90915561) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is 4-ethyl-5,11,12-trimethyl-6-(3-methylpent-3-en-1-ynyl)pentadeca-1,4-diene.
| Compound Name | 4-ethyl-5,11,12-trimethyl-6-(3-methylpent-3-en-1-ynyl)pentadeca-1,4-diene |
|---|---|
| PubChem CID | 90915561 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | 4-ethyl-5,11,12-trimethyl-6-(3-methylpent-3-en-1-ynyl)pentadeca-1,4-diene |
| SMILES | C=CCC(CC)=C(C)C(C#CC(C)=CC)CCCCC(C)C(C)CCC |
| InChI | InChI=1S/C26H44/c1-9-15-22(6)23(7)17-13-14-18-26(20-19-21(5)11-3)24(8)25(12-4)16-10-2/h10-11,22-23,26H,2,9,12-18H2,1,3-8H3 |
| InChIKey | GHEQPMGNSZBDPB-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|