C37H29F3N4O4S — CID 90915595
N-[2-(6-anilino-7-oxo-4-phenoxybenzo[e]perimidin-2-yl)-5-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane (PubChem CID 90915595) has the molecular formula C37H29F3N4O4S and a molecular weight of 682.72 g/mol. Its IUPAC name is N-[2-(6-anilino-7-oxo-4-phenoxybenzo[e]perimidin-2-yl)-5-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane.
| Compound Name | N-[2-(6-anilino-7-oxo-4-phenoxybenzo[e]perimidin-2-yl)-5-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane |
|---|---|
| PubChem CID | 90915595 |
| Molecular Formula | C37H29F3N4O4S |
| Molecular Weight | 682.72 g/mol |
| Exact Mass | 682.19 |
| IUPAC Name | N-[2-(6-anilino-7-oxo-4-phenoxybenzo[e]perimidin-2-yl)-5-methylphenyl]-1,1,1-trifluoromethanesulfonamide;ethane |
| SMILES | CC.Cc1ccc(-c2nc3c4c(c(Nc5ccccc5)cc(Oc5ccccc5)c4n2)C(=O)c2ccccc2-3)c(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C35H23F3N4O4S.C2H6/c1-20-16-17-25(26(18-20)42-47(44,45)35(36,37)38)34-40-31-23-14-8-9-15-24(23)33(43)29-27(39-21-10-4-2-5-11-21)19-28(32(41-34)30(29)31)46-22-12-6-3-7-13-22;1-2/h2-19,39,42H,1H3;1-2H3 |
| InChIKey | AROYWIBULJOGSJ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.72 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|