C38H41ClFNO8S2 — CID 90915905
2-(10-phenyldecanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate (PubChem CID 90915905) has the molecular formula C38H41ClFNO8S2 and a molecular weight of 758.33 g/mol. Its IUPAC name is 2-(10-phenyldecanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate.
| Compound Name | 2-(10-phenyldecanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90915905 |
| Molecular Formula | C38H41ClFNO8S2 |
| Molecular Weight | 758.33 g/mol |
| Exact Mass | 757.19 |
| IUPAC Name | 2-(10-phenyldecanoyloxy)ethyl 1-(2-chloro-6-fluorophenyl)-3-methyl-6,6,11,11-tetraoxo-2,5-dihydro-1H-[1,5]benzodithiepino[3,4-b]pyridine-2-carboxylate |
| SMILES | CC1=NC2=C(C(c3c(F)cccc3Cl)C1C(=O)OCCOC(=O)CCCCCCCCCc1ccccc1)S(=O)(=O)c1ccccc1S(=O)(=O)C2 |
| InChI | InChI=1S/C38H41ClFNO8S2/c1-26-34(38(43)49-24-23-48-33(42)22-11-6-4-2-3-5-8-15-27-16-9-7-10-17-27)36(35-28(39)18-14-19-29(35)40)37-30(41-26)25-50(44,45)31-20-12-13-21-32(31)51(37,46)47/h7,9-10,12-14,16-21,34,36H,2-6,8,11,15,22-25H2,1H3 |
| InChIKey | IPCGGVMRKOJPRG-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 133.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.33 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|