C17H24N6 — CID 90916255
ethane;2-N,2-N,6-N,9-tetramethyl-6-N-phenylpurine-2,6-diamine (PubChem CID 90916255) has the molecular formula C17H24N6 and a molecular weight of 312.42 g/mol. Its IUPAC name is ethane;2-N,2-N,6-N,9-tetramethyl-6-N-phenylpurine-2,6-diamine.
| Compound Name | ethane;2-N,2-N,6-N,9-tetramethyl-6-N-phenylpurine-2,6-diamine |
|---|---|
| PubChem CID | 90916255 |
| Molecular Formula | C17H24N6 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.21 |
| IUPAC Name | ethane;2-N,2-N,6-N,9-tetramethyl-6-N-phenylpurine-2,6-diamine |
| SMILES | CC.CN(C)c1nc(N(C)c2ccccc2)c2ncn(C)c2n1 |
| InChI | InChI=1S/C15H18N6.C2H6/c1-19(2)15-17-13-12(16-10-20(13)3)14(18-15)21(4)11-8-6-5-7-9-11;1-2/h5-10H,1-4H3;1-2H3 |
| InChIKey | NIMSGOCZNRSUDG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |