C15H25NO3 — CID 90916369
4-anilino-3-methyl-4-oxobutanoic acid;ethane (PubChem CID 90916369) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 4-anilino-3-methyl-4-oxobutanoic acid;ethane.
| Compound Name | 4-anilino-3-methyl-4-oxobutanoic acid;ethane |
|---|---|
| PubChem CID | 90916369 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 4-anilino-3-methyl-4-oxobutanoic acid;ethane |
| SMILES | CC.CC.CC(CC(=O)O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H13NO3.2C2H6/c1-8(7-10(13)14)11(15)12-9-5-3-2-4-6-9;2*1-2/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14);2*1-2H3 |
| InChIKey | JKGNFQCTGZBDCV-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |