C21H30O — CID 90916610
3-(3,7-dimethylnona-1,3,5,7-tetraenyl)-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde (PubChem CID 90916610) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 3-(3,7-dimethylnona-1,3,5,7-tetraenyl)-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde.
| Compound Name | 3-(3,7-dimethylnona-1,3,5,7-tetraenyl)-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 90916610 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 3-(3,7-dimethylnona-1,3,5,7-tetraenyl)-2,2,4-trimethylcyclohex-3-ene-1-carbaldehyde |
| SMILES | CC=C(C)C=CC=C(C)C=CC1=C(C)CCC(C=O)C1(C)C |
| InChI | InChI=1S/C21H30O/c1-7-16(2)9-8-10-17(3)11-14-20-18(4)12-13-19(15-22)21(20,5)6/h7-11,14-15,19H,12-13H2,1-6H3 |
| InChIKey | YJOCBZJGLLNRLD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|