C18H30F3N3O5S2 — CID 90916921
(2S)-2-[(2-methylsulfonylacetyl)-(2-piperidin-1-ylethyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide (PubChem CID 90916921) has the molecular formula C18H30F3N3O5S2 and a molecular weight of 489.58 g/mol. Its IUPAC name is (2S)-2-[(2-methylsulfonylacetyl)-(2-piperidin-1-ylethyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide.
| Compound Name | (2S)-2-[(2-methylsulfonylacetyl)-(2-piperidin-1-ylethyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
|---|---|
| PubChem CID | 90916921 |
| Molecular Formula | C18H30F3N3O5S2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (2S)-2-[(2-methylsulfonylacetyl)-(2-piperidin-1-ylethyl)amino]-5-(3,3,3-trifluoro-2-oxopropyl)sulfanylpentanamide |
| SMILES | CS(=O)(=O)CC(=O)N(CCN1CCCCC1)[C@@H](CCCSCC(=O)C(F)(F)F)C(N)=O |
| InChI | InChI=1S/C18H30F3N3O5S2/c1-31(28,29)13-16(26)24(10-9-23-7-3-2-4-8-23)14(17(22)27)6-5-11-30-12-15(25)18(19,20)21/h14H,2-13H2,1H3,(H2,22,27)/t14-/m0/s1 |
| InChIKey | BRYLTTIFLPJKFO-AWEZNQCLSA-N |
| XLogP | 0.84 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|