C24H21F3O2S — CID 90917085
[2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] acetate (PubChem CID 90917085) has the molecular formula C24H21F3O2S and a molecular weight of 430.49 g/mol. Its IUPAC name is [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] acetate.
| Compound Name | [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] acetate |
|---|---|
| PubChem CID | 90917085 |
| Molecular Formula | C24H21F3O2S |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [2-methyl-4-[1-[4-[4-(trifluoromethyl)phenyl]phenyl]ethylsulfanyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(SC(C)c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)cc1C |
| InChI | InChI=1S/C24H21F3O2S/c1-15-14-22(12-13-23(15)29-17(3)28)30-16(2)18-4-6-19(7-5-18)20-8-10-21(11-9-20)24(25,26)27/h4-14,16H,1-3H3 |
| InChIKey | GHNBVPUJCHBZHD-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|