C21H19O8P — CID 90917229
[(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] pyren-1-yl hydrogen phosphate (PubChem CID 90917229) has the molecular formula C21H19O8P and a molecular weight of 430.35 g/mol. Its IUPAC name is [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] pyren-1-yl hydrogen phosphate.
| Compound Name | [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] pyren-1-yl hydrogen phosphate |
|---|---|
| PubChem CID | 90917229 |
| Molecular Formula | C21H19O8P |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | [(2S,4S,5R)-2,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl] pyren-1-yl hydrogen phosphate |
| SMILES | O=P(O)(Oc1ccc2ccc3cccc4ccc1c2c34)O[C@]1(O)C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C21H19O8P/c22-11-18-16(23)10-21(24,27-18)29-30(25,26)28-17-9-7-14-5-4-12-2-1-3-13-6-8-15(17)20(14)19(12)13/h1-9,16,18,22-24H,10-11H2,(H,25,26)/t16-,18+,21-/m0/s1 |
| InChIKey | LQVVXSPWECIZKE-CDXJDZJCSA-N |
| XLogP | 2.87 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|