C24H40O11Si — CID 90917233
2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol;(3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate (PubChem CID 90917233) has the molecular formula C24H40O11Si and a molecular weight of 532.66 g/mol. Its IUPAC name is 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol;(3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate.
| Compound Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol;(3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate |
|---|---|
| PubChem CID | 90917233 |
| Molecular Formula | C24H40O11Si |
| Molecular Weight | 532.66 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,4-dihydro-2H-pyran-3,4-diol;(3,4-diacetyloxy-3,4-dihydro-2H-pyran-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC=CC(OC(C)=O)C1OC(C)=O.CC(C)(C)[Si](C)(C)OCC1OC=CC(O)C1O |
| InChI | InChI=1S/C12H16O7.C12H24O4Si/c1-7(13)17-6-11-12(19-9(3)15)10(4-5-16-11)18-8(2)14;1-12(2,3)17(4,5)16-8-10-11(14)9(13)6-7-15-10/h4-5,10-12H,6H2,1-3H3;6-7,9-11,13-14H,8H2,1-5H3 |
| InChIKey | QIKFNZBBRAKKPR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.66 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|