C38H70O2Si2 — CID 90917274
[1-[2-[2-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane (PubChem CID 90917274) has the molecular formula C38H70O2Si2 and a molecular weight of 615.15 g/mol. Its IUPAC name is [1-[2-[2-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane.
| Compound Name | [1-[2-[2-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 90917274 |
| Molecular Formula | C38H70O2Si2 |
| Molecular Weight | 615.15 g/mol |
| Exact Mass | 614.49 |
| IUPAC Name | [1-[2-[2-[di(propan-2-yl)-prop-2-enylsilyl]oxy-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-yl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]oxy-di(propan-2-yl)-prop-2-enylsilane |
| SMILES | C=CC[Si](OC1CC2CCCCC2C1CCC1C(O[Si](CC=C)(C(C)C)C(C)C)CC2CCCCC21)(C(C)C)C(C)C |
| InChI | InChI=1S/C38H70O2Si2/c1-11-23-41(27(3)4,28(5)6)39-37-25-31-17-13-15-19-33(31)35(37)21-22-36-34-20-16-14-18-32(34)26-38(36)40-42(24-12-2,29(7)8)30(9)10/h11-12,27-38H,1-2,13-26H2,3-10H3 |
| InChIKey | AKJIONZVEJFTNH-UHFFFAOYSA-N |
| XLogP | 12.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.15 |
| LogP ≤ 5 | 12.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|