About 8-chloro-3,4-dihydro-1H-isochromene
8-chloro-3,4-dihydro-1H-isochromene (PubChem CID 90917909) has the molecular formula C9H9ClO
and a molecular weight of 168.62 g/mol. Its IUPAC name is 8-chloro-3,4-dihydro-1H-isochromene.
Molecular Properties
| Compound Name | 8-chloro-3,4-dihydro-1H-isochromene |
| PubChem CID | 90917909 |
| Molecular Formula | C9H9ClO |
| Molecular Weight | 168.62 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | 8-chloro-3,4-dihydro-1H-isochromene |
| SMILES | Clc1cccc2c1COCC2 |
| InChI | InChI=1S/C9H9ClO/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-3H,4-6H2 |
| InChIKey | HCELCXWWJXFNLO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.62 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-chloro-3,4-dihydro-1H-isochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3,4-dihydro-1H-isochromene?
The IUPAC name of 8-chloro-3,4-dihydro-1H-isochromene (CID 90917909) is 8-chloro-3,4-dihydro-1H-isochromene.
What is the SMILES notation for 8-chloro-3,4-dihydro-1H-isochromene?
The canonical SMILES for 8-chloro-3,4-dihydro-1H-isochromene is Clc1cccc2c1COCC2.
What is the InChIKey of 8-chloro-3,4-dihydro-1H-isochromene?
The InChIKey is HCELCXWWJXFNLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO/c10-9-3-1-2-7-4-5-11-6-8(7)9/h1-3H,4-6H2.
What are the key properties of 8-chloro-3,4-dihydro-1H-isochromene?
8-chloro-3,4-dihydro-1H-isochromene has a molecular weight of 168.62 g/mol, XLogP of 2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3,4-dihydro-1H-isochromene is sourced from PubChem (CID 90917909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).